C17H28N2O5Si — CID 89154951
1-[(1R,3R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione (PubChem CID 89154951) has the molecular formula C17H28N2O5Si and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-[(1R,3R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,3R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89154951 |
| Molecular Formula | C17H28N2O5Si |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[(1R,3R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
| SMILES | CC[C@]12COC([C@H](n3ccc(=O)[nH]c3=O)O1)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28N2O5Si/c1-7-17-10-22-12(13(17)24-25(5,6)16(2,3)4)14(23-17)19-9-8-11(20)18-15(19)21/h8-9,12-14H,7,10H2,1-6H3,(H,18,20,21)/t12?,13-,14+,17+/m0/s1 |
| InChIKey | HKGUFKHZHOPVKJ-RUMXQMEISA-N |
| XLogP | 2.00 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|