C24H24N2O6 — CID 57310848
1-[(1S,3R,4R,7S)-7-phenylmethoxy-1-(phenylmethoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione (PubChem CID 57310848) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 1-[(1S,3R,4R,7S)-7-phenylmethoxy-1-(phenylmethoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1S,3R,4R,7S)-7-phenylmethoxy-1-(phenylmethoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57310848 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[(1S,3R,4R,7S)-7-phenylmethoxy-1-(phenylmethoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@@]3(COCc4ccccc4)CO[C@@H]2[C@@H]3OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H24N2O6/c27-19-11-12-26(23(28)25-19)22-20-21(30-14-18-9-5-2-6-10-18)24(32-22,16-31-20)15-29-13-17-7-3-1-4-8-17/h1-12,20-22H,13-16H2,(H,25,27,28)/t20-,21+,22-,24+/m1/s1 |
| InChIKey | UJNOAEGRZNERIK-GBAAUQCPSA-N |
| XLogP | 2.01 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |