C25H27N5O8S — CID 72714145
[(2R,3R,4S,5R)-5-(azidomethyl)-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 72714145) has the molecular formula C25H27N5O8S and a molecular weight of 557.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(azidomethyl)-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4S,5R)-5-(azidomethyl)-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 72714145 |
| Molecular Formula | C25H27N5O8S |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(azidomethyl)-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1[C@H](n2ccc(=O)[nH]c2=O)O[C@](CN=[N+]=[N-])(COCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H27N5O8S/c1-39(33,34)38-21-22(36-15-19-10-6-3-7-11-19)25(16-27-29-26,17-35-14-18-8-4-2-5-9-18)37-23(21)30-13-12-20(31)28-24(30)32/h2-13,21-23H,14-17H2,1H3,(H,28,31,32)/t21-,22+,23-,25-/m1/s1 |
| InChIKey | AQVPYDXIHATCFK-STAYPELNSA-N |
| XLogP | 2.26 |
| TPSA | 174.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|