C34H33N3O9S — CID 45104737
[(2R,3S,4S,5S)-2-(2,4-dioxopyrimidin-1-yl)-5-[(methylideneamino)oxymethyl]-4-(naphthalen-2-ylmethoxy)-5-(naphthalen-2-ylmethoxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 45104737) has the molecular formula C34H33N3O9S and a molecular weight of 659.72 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-2-(2,4-dioxopyrimidin-1-yl)-5-[(methylideneamino)oxymethyl]-4-(naphthalen-2-ylmethoxy)-5-(naphthalen-2-ylmethoxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,4S,5S)-2-(2,4-dioxopyrimidin-1-yl)-5-[(methylideneamino)oxymethyl]-4-(naphthalen-2-ylmethoxy)-5-(naphthalen-2-ylmethoxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 45104737 |
| Molecular Formula | C34H33N3O9S |
| Molecular Weight | 659.72 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | [(2R,3S,4S,5S)-2-(2,4-dioxopyrimidin-1-yl)-5-[(methylideneamino)oxymethyl]-4-(naphthalen-2-ylmethoxy)-5-(naphthalen-2-ylmethoxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | C=NOC[C@]1(COCc2ccc3ccccc3c2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](OS(C)(=O)=O)[C@@H]1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H33N3O9S/c1-35-44-22-34(21-42-19-23-11-13-25-7-3-5-9-27(25)17-23)31(43-20-24-12-14-26-8-4-6-10-28(26)18-24)30(46-47(2,40)41)32(45-34)37-16-15-29(38)36-33(37)39/h3-18,30-32H,1,19-22H2,2H3,(H,36,38,39)/t30-,31-,32+,34-/m0/s1 |
| InChIKey | IHQBNTBEDLIDDW-SGLIHVKSSA-N |
| XLogP | 3.89 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|