C33H31N3O6 — CID 45104832
1-[(1R,5S,7R,8S)-2-methyl-8-(naphthalen-2-ylmethoxy)-5-(naphthalen-2-ylmethoxymethyl)-3,6-dioxa-2-azabicyclo[3.2.1]octan-7-yl]pyrimidine-2,4-dione (PubChem CID 45104832) has the molecular formula C33H31N3O6 and a molecular weight of 565.63 g/mol. Its IUPAC name is 1-[(1R,5S,7R,8S)-2-methyl-8-(naphthalen-2-ylmethoxy)-5-(naphthalen-2-ylmethoxymethyl)-3,6-dioxa-2-azabicyclo[3.2.1]octan-7-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,5S,7R,8S)-2-methyl-8-(naphthalen-2-ylmethoxy)-5-(naphthalen-2-ylmethoxymethyl)-3,6-dioxa-2-azabicyclo[3.2.1]octan-7-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 45104832 |
| Molecular Formula | C33H31N3O6 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 1-[(1R,5S,7R,8S)-2-methyl-8-(naphthalen-2-ylmethoxy)-5-(naphthalen-2-ylmethoxymethyl)-3,6-dioxa-2-azabicyclo[3.2.1]octan-7-yl]pyrimidine-2,4-dione |
| SMILES | CN1OC[C@]2(COCc3ccc4ccccc4c3)O[C@@H](n3ccc(=O)[nH]c3=O)[C@H]1[C@@H]2OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H31N3O6/c1-35-29-30(40-19-23-11-13-25-7-3-5-9-27(25)17-23)33(21-41-35,42-31(29)36-15-14-28(37)34-32(36)38)20-39-18-22-10-12-24-6-2-4-8-26(24)16-22/h2-17,29-31H,18-21H2,1H3,(H,34,37,38)/t29-,30+,31-,33+/m1/s1 |
| InChIKey | SPWBVKVWJCFEFN-GARBSBLASA-N |
| XLogP | 4.16 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |