C11H15N3O6 — CID 45104833
1-[(1R,5S,7R,8S)-8-hydroxy-5-(hydroxymethyl)-2-methyl-3,6-dioxa-2-azabicyclo[3.2.1]octan-7-yl]pyrimidine-2,4-dione (PubChem CID 45104833) has the molecular formula C11H15N3O6 and a molecular weight of 285.26 g/mol. Its IUPAC name is 1-[(1R,5S,7R,8S)-8-hydroxy-5-(hydroxymethyl)-2-methyl-3,6-dioxa-2-azabicyclo[3.2.1]octan-7-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,5S,7R,8S)-8-hydroxy-5-(hydroxymethyl)-2-methyl-3,6-dioxa-2-azabicyclo[3.2.1]octan-7-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 45104833 |
| Molecular Formula | C11H15N3O6 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[(1R,5S,7R,8S)-8-hydroxy-5-(hydroxymethyl)-2-methyl-3,6-dioxa-2-azabicyclo[3.2.1]octan-7-yl]pyrimidine-2,4-dione |
| SMILES | CN1OC[C@]2(CO)O[C@@H](n3ccc(=O)[nH]c3=O)[C@H]1[C@@H]2O |
| InChI | InChI=1S/C11H15N3O6/c1-13-7-8(17)11(4-15,5-19-13)20-9(7)14-3-2-6(16)12-10(14)18/h2-3,7-9,15,17H,4-5H2,1H3,(H,12,16,18)/t7-,8+,9-,11+/m1/s1 |
| InChIKey | DQFPUWYQSYUPRO-LOKLDPHHSA-N |
| XLogP | -2.60 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |