C23H24N2O8 — CID 134833669
[(2R,3R,4R,5R,9S)-3-acetyloxy-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-1-oxaspiro[4.4]non-6-en-9-yl] acetate (PubChem CID 134833669) has the molecular formula C23H24N2O8 and a molecular weight of 456.45 g/mol. Its IUPAC name is [(2R,3R,4R,5R,9S)-3-acetyloxy-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-1-oxaspiro[4.4]non-6-en-9-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,9S)-3-acetyloxy-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-1-oxaspiro[4.4]non-6-en-9-yl] acetate |
|---|---|
| PubChem CID | 134833669 |
| Molecular Formula | C23H24N2O8 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [(2R,3R,4R,5R,9S)-3-acetyloxy-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxy-1-oxaspiro[4.4]non-6-en-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](n2ccc(=O)[nH]c2=O)O[C@@]2(C=CC[C@@H]2OC(C)=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O8/c1-14(26)31-17-9-6-11-23(17)20(30-13-16-7-4-3-5-8-16)19(32-15(2)27)21(33-23)25-12-10-18(28)24-22(25)29/h3-8,10-12,17,19-21H,9,13H2,1-2H3,(H,24,28,29)/t17-,19+,20+,21+,23+/m0/s1 |
| InChIKey | LEMKJPSPHPFBGY-DPCCUFRHSA-N |
| XLogP | 1.21 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|