C20H22N2O7 — CID 70169308
[(1R,3R,4R,8S)-3-(2,4-dioxopyrimidin-1-yl)-8-phenylmethoxy-2,6-dioxabicyclo[3.2.1]octan-4-yl]methyl acetate (PubChem CID 70169308) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(1R,3R,4R,8S)-3-(2,4-dioxopyrimidin-1-yl)-8-phenylmethoxy-2,6-dioxabicyclo[3.2.1]octan-4-yl]methyl acetate.
| Compound Name | [(1R,3R,4R,8S)-3-(2,4-dioxopyrimidin-1-yl)-8-phenylmethoxy-2,6-dioxabicyclo[3.2.1]octan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 70169308 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [(1R,3R,4R,8S)-3-(2,4-dioxopyrimidin-1-yl)-8-phenylmethoxy-2,6-dioxabicyclo[3.2.1]octan-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C2OC[C@@H](O[C@H]1n1ccc(=O)[nH]c1=O)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C20H22N2O7/c1-12(23)26-10-14-17-18(27-9-13-5-3-2-4-6-13)15(11-28-17)29-19(14)22-8-7-16(24)21-20(22)25/h2-8,14-15,17-19H,9-11H2,1H3,(H,21,24,25)/t14-,15-,17?,18-,19-/m1/s1 |
| InChIKey | NYDCRWQHWIFXEF-AUVSIERWSA-N |
| XLogP | 0.60 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |