C23H29N3O8 — CID 135012486
methyl (2R)-2-amino-2-[(2R,3R,4R,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl]acetate (PubChem CID 135012486) has the molecular formula C23H29N3O8 and a molecular weight of 475.50 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-[(2R,3R,4R,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl]acetate.
| Compound Name | methyl (2R)-2-amino-2-[(2R,3R,4R,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl]acetate |
|---|---|
| PubChem CID | 135012486 |
| Molecular Formula | C23H29N3O8 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | methyl (2R)-2-amino-2-[(2R,3R,4R,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl]acetate |
| SMILES | COC(=O)[C@H](N)[C@@H]1[C@@H](OCc2ccccc2)[C@@H](C2COC(C)(C)O2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H29N3O8/c1-23(2)32-12-14(34-23)18-19(31-11-13-7-5-4-6-8-13)16(17(24)21(28)30-3)20(33-18)26-10-9-15(27)25-22(26)29/h4-10,14,16-20H,11-12,24H2,1-3H3,(H,25,27,29)/t14?,16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | ZZDZHSPKDURGIH-YORDWOLRSA-N |
| XLogP | 0.29 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |