C21H26N2O12S2 — CID 102413502
[(2R,3R,4R,5S)-5-[1,2-bis(methylsulfonyloxy)ethyl]-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] acetate (PubChem CID 102413502) has the molecular formula C21H26N2O12S2 and a molecular weight of 562.58 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-[1,2-bis(methylsulfonyloxy)ethyl]-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-5-[1,2-bis(methylsulfonyloxy)ethyl]-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 102413502 |
| Molecular Formula | C21H26N2O12S2 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | [(2R,3R,4R,5S)-5-[1,2-bis(methylsulfonyloxy)ethyl]-2-(2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OCc2ccccc2)[C@@H](C(COS(C)(=O)=O)OS(C)(=O)=O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C21H26N2O12S2/c1-13(24)33-19-18(31-11-14-7-5-4-6-8-14)17(15(35-37(3,29)30)12-32-36(2,27)28)34-20(19)23-10-9-16(25)22-21(23)26/h4-10,15,17-20H,11-12H2,1-3H3,(H,22,25,26)/t15?,17-,18-,19-,20-/m1/s1 |
| InChIKey | LLJHITJAPOADCZ-HYWOXHDXSA-N |
| XLogP | -0.73 |
| TPSA | 186.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|