C26H27N3O8 — CID 10324023
[(1R,2S,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-2-nitro-4,5-bis(phenylmethoxy)cyclopentyl]methyl acetate (PubChem CID 10324023) has the molecular formula C26H27N3O8 and a molecular weight of 509.52 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-2-nitro-4,5-bis(phenylmethoxy)cyclopentyl]methyl acetate.
| Compound Name | [(1R,2S,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-2-nitro-4,5-bis(phenylmethoxy)cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 10324023 |
| Molecular Formula | C26H27N3O8 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-2-nitro-4,5-bis(phenylmethoxy)cyclopentyl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](n2ccc(=O)[nH]c2=O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27N3O8/c1-17(30)35-16-20-22(29(33)34)23(28-13-12-21(31)27-26(28)32)25(37-15-19-10-6-3-7-11-19)24(20)36-14-18-8-4-2-5-9-18/h2-13,20,22-25H,14-16H2,1H3,(H,27,31,32)/t20-,22-,23+,24+,25+/m0/s1 |
| InChIKey | WDACHFDAYXZALH-YNTGQKLOSA-N |
| XLogP | 2.09 |
| TPSA | 142.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|