C17H28IN3O4Si — CID 71042312
4-amino-1-[(1S,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-iodopyrimidin-2-one (PubChem CID 71042312) has the molecular formula C17H28IN3O4Si and a molecular weight of 493.42 g/mol. Its IUPAC name is 4-amino-1-[(1S,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-iodopyrimidin-2-one.
| Compound Name | 4-amino-1-[(1S,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-iodopyrimidin-2-one |
|---|---|
| PubChem CID | 71042312 |
| Molecular Formula | C17H28IN3O4Si |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 4-amino-1-[(1S,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-iodopyrimidin-2-one |
| SMILES | CC[C@@]12COC([C@H](n3cc(I)c(N)nc3=O)O1)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28IN3O4Si/c1-7-17-9-23-11(12(17)25-26(5,6)16(2,3)4)14(24-17)21-8-10(18)13(19)20-15(21)22/h8,11-12,14H,7,9H2,1-6H3,(H2,19,20,22)/t11?,12-,14-,17+/m1/s1 |
| InChIKey | WMAIUHBAWZQXKO-PEAXJVGTSA-N |
| XLogP | 2.90 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|