C20H33N3O4 — CID 161465603
4-amino-1-[(1R,5S,7R,8S)-5-(2,2-dimethylpropyl)-8-[(2-methylpropan-2-yl)oxy]-2,6-dioxabicyclo[3.2.1]octan-7-yl]-5-methylpyrimidin-2-one (PubChem CID 161465603) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-amino-1-[(1R,5S,7R,8S)-5-(2,2-dimethylpropyl)-8-[(2-methylpropan-2-yl)oxy]-2,6-dioxabicyclo[3.2.1]octan-7-yl]-5-methylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(1R,5S,7R,8S)-5-(2,2-dimethylpropyl)-8-[(2-methylpropan-2-yl)oxy]-2,6-dioxabicyclo[3.2.1]octan-7-yl]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 161465603 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 4-amino-1-[(1R,5S,7R,8S)-5-(2,2-dimethylpropyl)-8-[(2-methylpropan-2-yl)oxy]-2,6-dioxabicyclo[3.2.1]octan-7-yl]-5-methylpyrimidin-2-one |
| SMILES | Cc1cn([C@@H]2O[C@@]3(CC(C)(C)C)CCO[C@@H]2[C@@H]3OC(C)(C)C)c(=O)nc1N |
| InChI | InChI=1S/C20H33N3O4/c1-12-10-23(17(24)22-15(12)21)16-13-14(26-19(5,6)7)20(27-16,8-9-25-13)11-18(2,3)4/h10,13-14,16H,8-9,11H2,1-7H3,(H2,21,22,24)/t13-,14+,16-,20-/m1/s1 |
| InChIKey | GDJOFPXTXQUKPE-FKEXNYPISA-N |
| XLogP | 2.81 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |