C11H13IN2O5 — CID 159283519
1-[(1S,3R,4S)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 159283519) has the molecular formula C11H13IN2O5 and a molecular weight of 380.14 g/mol. Its IUPAC name is 1-[(1S,3R,4S)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(1S,3R,4S)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159283519 |
| Molecular Formula | C11H13IN2O5 |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 1-[(1S,3R,4S)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | CC[C@]12CO[C@@H](C1O)[C@H](n1cc(I)c(=O)[nH]c1=O)O2 |
| InChI | InChI=1S/C11H13IN2O5/c1-2-11-4-18-6(7(11)15)9(19-11)14-3-5(12)8(16)13-10(14)17/h3,6-7,9,15H,2,4H2,1H3,(H,13,16,17)/t6-,7?,9+,11-/m0/s1 |
| InChIKey | BMIPROSOBMVPPA-NAUWVDHNSA-N |
| XLogP | -0.42 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|