C11H15N2O9P — CID 102301531
[(1S,3R,7S)-1-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl] dihydrogen phosphate (PubChem CID 102301531) has the molecular formula C11H15N2O9P and a molecular weight of 350.22 g/mol. Its IUPAC name is [(1S,3R,7S)-1-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl] dihydrogen phosphate.
| Compound Name | [(1S,3R,7S)-1-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 102301531 |
| Molecular Formula | C11H15N2O9P |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | [(1S,3R,7S)-1-(hydroxymethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl] dihydrogen phosphate |
| SMILES | Cc1cn([C@@H]2O[C@@]3(CO)COC2[C@@H]3OP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N2O9P/c1-5-2-13(10(16)12-8(5)15)9-6-7(22-23(17,18)19)11(3-14,21-9)4-20-6/h2,6-7,9,14H,3-4H2,1H3,(H,12,15,16)(H2,17,18,19)/t6?,7-,9+,11-/m0/s1 |
| InChIKey | NQUKZHLFMPDJCE-JAQZQLGHSA-N |
| XLogP | -2.02 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|