C13H18B2N2O6P2 — CID 167542295
5-methyl-1-[(1R,3S,4R,7S)-7-[methyl(phosphoroso)boranyl]-1-[[methyl(phosphoroso)boranyl]methyl]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione (PubChem CID 167542295) has the molecular formula C13H18B2N2O6P2 and a molecular weight of 381.87 g/mol. Its IUPAC name is 5-methyl-1-[(1R,3S,4R,7S)-7-[methyl(phosphoroso)boranyl]-1-[[methyl(phosphoroso)boranyl]methyl]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(1R,3S,4R,7S)-7-[methyl(phosphoroso)boranyl]-1-[[methyl(phosphoroso)boranyl]methyl]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167542295 |
| Molecular Formula | C13H18B2N2O6P2 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 5-methyl-1-[(1R,3S,4R,7S)-7-[methyl(phosphoroso)boranyl]-1-[[methyl(phosphoroso)boranyl]methyl]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]pyrimidine-2,4-dione |
| SMILES | CB(C[C@@]12CO[C@@H]([C@@H](n3cc(C)c(=O)[nH]c3=O)O1)[C@@H]2B(C)P=O)P=O |
| InChI | InChI=1S/C13H18B2N2O6P2/c1-7-4-17(12(19)16-10(7)18)11-8-9(15(3)25-21)13(23-11,6-22-8)5-14(2)24-20/h4,8-9,11H,5-6H2,1-3H3,(H,16,18,19)/t8-,9+,11+,13+/m1/s1 |
| InChIKey | HMJQFGMXTQRNIZ-KOVQTIFSSA-N |
| XLogP | 1.71 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|