C13H14N2O5 — CID 89216248
1-[(1R,3R,4R)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-ethynylpyrimidine-2,4-dione (PubChem CID 89216248) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-[(1R,3R,4R)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-ethynylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,3R,4R)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-ethynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89216248 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-[(1R,3R,4R)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-ethynylpyrimidine-2,4-dione |
| SMILES | C#Cc1cn([C@@H]2O[C@]3(CC)CO[C@@H]2C3O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H14N2O5/c1-3-7-5-15(12(18)14-10(7)17)11-8-9(16)13(4-2,20-11)6-19-8/h1,5,8-9,11,16H,4,6H2,2H3,(H,14,17,18)/t8-,9?,11-,13-/m1/s1 |
| InChIKey | PLJLSMBOQBOYDL-SIVTZQACSA-N |
| XLogP | -1.04 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|