C10H10N2O5 — CID 87523895
5-ethynyl-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidine-2,4-dione (PubChem CID 87523895) has the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. Its IUPAC name is 5-ethynyl-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidine-2,4-dione.
| Compound Name | 5-ethynyl-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87523895 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 5-ethynyl-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidine-2,4-dione |
| SMILES | C#Cc1cn([C@@H]2CO[C@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H10N2O5/c1-2-6-3-12(10(15)11-9(6)14)7-5-16-8(4-13)17-7/h1,3,7-8,13H,4-5H2,(H,11,14,15)/t7-,8-/m0/s1 |
| InChIKey | NVJYVJXEABGRKL-YUMQZZPRSA-N |
| XLogP | -1.62 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|