C11H11FN2O4 — CID 178033563
5-ethynyl-1-[3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 178033563) has the molecular formula C11H11FN2O4 and a molecular weight of 254.22 g/mol. Its IUPAC name is 5-ethynyl-1-[3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-ethynyl-1-[3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178033563 |
| Molecular Formula | C11H11FN2O4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-ethynyl-1-[3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#Cc1cn(C2OC(CO)CC2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H11FN2O4/c1-2-6-4-14(11(17)13-9(6)16)10-8(12)3-7(5-15)18-10/h1,4,7-8,10,15H,3,5H2,(H,13,16,17) |
| InChIKey | TZGXALZCRUACON-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|