C11H12LiN2O8P — CID 23695968
lithium [(2S,4R,5R)-5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 23695968) has the molecular formula C11H12LiN2O8P and a molecular weight of 338.14 g/mol. Its IUPAC name is lithium [(2S,4R,5R)-5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | lithium [(2S,4R,5R)-5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 23695968 |
| Molecular Formula | C11H12LiN2O8P |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | lithium [(2S,4R,5R)-5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | C#Cc1cn([C@@H]2O[C@H](COP(=O)([O-])O)C[C@H]2O)c(=O)[nH]c1=O.[Li+] |
| InChI | InChI=1S/C11H13N2O8P.Li/c1-2-6-4-13(11(16)12-9(6)15)10-8(14)3-7(21-10)5-20-22(17,18)19;/h1,4,7-8,10,14H,3,5H2,(H,12,15,16)(H2,17,18,19);/q;+1/p-1/t7-,8+,10+;/m0./s1 |
| InChIKey | WTEKWAPJXKFAKB-GZJXKWBNSA-M |
| XLogP | -5.35 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|