C9H11N3O7 — CID 58492894
1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidine-2,4-dione (PubChem CID 58492894) has the molecular formula C9H11N3O7 and a molecular weight of 273.20 g/mol. Its IUPAC name is 1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58492894 |
| Molecular Formula | C9H11N3O7 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)CC2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N3O7/c13-3-4-1-6(14)8(19-4)11-2-5(12(17)18)7(15)10-9(11)16/h2,4,6,8,13-14H,1,3H2,(H,10,15,16)/t4-,6?,8+/m0/s1 |
| InChIKey | LDDCJZWYKPBFMY-NVBZKYLBSA-N |
| XLogP | -1.91 |
| TPSA | 147.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|