C13H13BrN2O6 — CID 5279542
[(2R,3R,5S)-2-[5-(2-bromoethynyl)-2,4-dioxopyrimidin-1-yl]-5-(hydroxymethyl)oxolan-3-yl] acetate (PubChem CID 5279542) has the molecular formula C13H13BrN2O6 and a molecular weight of 373.16 g/mol. Its IUPAC name is [(2R,3R,5S)-2-[5-(2-bromoethynyl)-2,4-dioxopyrimidin-1-yl]-5-(hydroxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5S)-2-[5-(2-bromoethynyl)-2,4-dioxopyrimidin-1-yl]-5-(hydroxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 5279542 |
| Molecular Formula | C13H13BrN2O6 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | [(2R,3R,5S)-2-[5-(2-bromoethynyl)-2,4-dioxopyrimidin-1-yl]-5-(hydroxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](CO)O[C@H]1n1cc(C#CBr)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H13BrN2O6/c1-7(18)21-10-4-9(6-17)22-12(10)16-5-8(2-3-14)11(19)15-13(16)20/h5,9-10,12,17H,4,6H2,1H3,(H,15,19,20)/t9-,10+,12+/m0/s1 |
| InChIKey | FTNFOFFXCGPPOK-HOSYDEDBSA-N |
| XLogP | -0.55 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|