C15H15IN2O7 — CID 68941707
[(2S,4R,5R)-4-acetyloxy-5-[5-(2-iodoethynyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 68941707) has the molecular formula C15H15IN2O7 and a molecular weight of 462.20 g/mol. Its IUPAC name is [(2S,4R,5R)-4-acetyloxy-5-[5-(2-iodoethynyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,4R,5R)-4-acetyloxy-5-[5-(2-iodoethynyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68941707 |
| Molecular Formula | C15H15IN2O7 |
| Molecular Weight | 462.20 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | [(2S,4R,5R)-4-acetyloxy-5-[5-(2-iodoethynyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@@H](OC(C)=O)[C@H](n2cc(C#CI)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C15H15IN2O7/c1-8(19)23-7-11-5-12(24-9(2)20)14(25-11)18-6-10(3-4-16)13(21)17-15(18)22/h6,11-12,14H,5,7H2,1-2H3,(H,17,21,22)/t11-,12+,14+/m0/s1 |
| InChIKey | IPHNGFUJSAUYRQ-OUCADQQQSA-N |
| XLogP | 0.06 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|