C11H16ClFN2O4 — CID 169190487
chloromethane;1-[(3S)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 169190487) has the molecular formula C11H16ClFN2O4 and a molecular weight of 294.71 g/mol. Its IUPAC name is chloromethane;1-[(3S)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | chloromethane;1-[(3S)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169190487 |
| Molecular Formula | C11H16ClFN2O4 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | chloromethane;1-[(3S)-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCl.Cc1cn(C2OC(CO)C[C@@H]2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13FN2O4.CH3Cl/c1-5-3-13(10(16)12-8(5)15)9-7(11)2-6(4-14)17-9;1-2/h3,6-7,9,14H,2,4H2,1H3,(H,12,15,16);1H3/t6?,7-,9?;/m0./s1 |
| InChIKey | GEQDMIRVLARRTJ-VEASCYRISA-N |
| XLogP | 0.32 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|