C9H11N3O7S — CID 11077595
1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-5-nitropyrimidine-2,4-dione (PubChem CID 11077595) has the molecular formula C9H11N3O7S and a molecular weight of 305.27 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11077595 |
| Molecular Formula | C9H11N3O7S |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-5-nitropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2S[C@@H](CO)[C@@H](O)[C@H]2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N3O7S/c13-2-4-5(14)6(15)8(20-4)11-1-3(12(18)19)7(16)10-9(11)17/h1,4-6,8,13-15H,2H2,(H,10,16,17)/t4-,5+,6+,8-/m0/s1 |
| InChIKey | YEPGYLUXMOEJOP-FJDLHZNMSA-N |
| XLogP | -2.23 |
| TPSA | 158.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|