C10H13BrN2O5S — CID 11035581
5-bromo-1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-6-methylpyrimidine-2,4-dione (PubChem CID 11035581) has the molecular formula C10H13BrN2O5S and a molecular weight of 353.19 g/mol. Its IUPAC name is 5-bromo-1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-6-methylpyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-6-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11035581 |
| Molecular Formula | C10H13BrN2O5S |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 5-bromo-1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)thiolan-2-yl]-6-methylpyrimidine-2,4-dione |
| SMILES | Cc1c(Br)c(=O)[nH]c(=O)n1[C@H]1S[C@@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13BrN2O5S/c1-3-5(11)8(17)12-10(18)13(3)9-7(16)6(15)4(2-14)19-9/h4,6-7,9,14-16H,2H2,1H3,(H,12,17,18)/t4-,6+,7+,9-/m0/s1 |
| InChIKey | JLWLSMKCOVAVHZ-WFEJWRNESA-N |
| XLogP | -1.06 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |