C6H4N3O6- — CID 7175713
2-(5-nitro-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 7175713) has the molecular formula C6H4N3O6- and a molecular weight of 214.11 g/mol. Its IUPAC name is 2-(5-nitro-2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | 2-(5-nitro-2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 7175713 |
| Molecular Formula | C6H4N3O6- |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2-(5-nitro-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | O=C([O-])Cn1cc([N+](=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H5N3O6/c10-4(11)2-8-1-3(9(14)15)5(12)7-6(8)13/h1H,2H2,(H,10,11)(H,7,12,13)/p-1 |
| InChIKey | YTIVWMOCZYRTFQ-UHFFFAOYSA-M |
| XLogP | -2.81 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|