C9H12N4O6 — CID 67463831
4-amino-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidin-2-one (PubChem CID 67463831) has the molecular formula C9H12N4O6 and a molecular weight of 272.22 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidin-2-one |
|---|---|
| PubChem CID | 67463831 |
| Molecular Formula | C9H12N4O6 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-amino-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@@H]2O[C@H](CO)C[C@H]2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O6/c10-7-5(13(17)18)2-12(9(16)11-7)8-6(15)1-4(3-14)19-8/h2,4,6,8,14-15H,1,3H2,(H2,10,11,16)/t4-,6+,8+/m0/s1 |
| InChIKey | OMLUXXHGDNOZLO-CVTKMRTPSA-N |
| XLogP | -1.63 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|