C11H14IN3O5 — CID 91152277
4-(hydroxyamino)-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-iodoethenyl)pyrimidin-2-one (PubChem CID 91152277) has the molecular formula C11H14IN3O5 and a molecular weight of 395.15 g/mol. Its IUPAC name is 4-(hydroxyamino)-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-iodoethenyl)pyrimidin-2-one.
| Compound Name | 4-(hydroxyamino)-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-iodoethenyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 91152277 |
| Molecular Formula | C11H14IN3O5 |
| Molecular Weight | 395.15 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 4-(hydroxyamino)-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-iodoethenyl)pyrimidin-2-one |
| SMILES | O=c1nc(NO)c(C=CI)cn1[C@@H]1O[C@H](CO)CC1O |
| InChI | InChI=1S/C11H14IN3O5/c12-2-1-6-4-15(11(18)13-9(6)14-19)10-8(17)3-7(5-16)20-10/h1-2,4,7-8,10,16-17,19H,3,5H2,(H,13,14,18)/t7-,8?,10+/m0/s1 |
| InChIKey | NDDARGIGTYCVOD-HKJUDDBKSA-N |
| XLogP | 0.09 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|