C15H18IN3O7 — CID 87409193
[(2S,4R,5R)-4-acetyloxy-5-[4-(hydroxyamino)-5-[(E)-2-iodoethenyl]-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 87409193) has the molecular formula C15H18IN3O7 and a molecular weight of 479.23 g/mol. Its IUPAC name is [(2S,4R,5R)-4-acetyloxy-5-[4-(hydroxyamino)-5-[(E)-2-iodoethenyl]-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,4R,5R)-4-acetyloxy-5-[4-(hydroxyamino)-5-[(E)-2-iodoethenyl]-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87409193 |
| Molecular Formula | C15H18IN3O7 |
| Molecular Weight | 479.23 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | [(2S,4R,5R)-4-acetyloxy-5-[4-(hydroxyamino)-5-[(E)-2-iodoethenyl]-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@@H](OC(C)=O)[C@H](n2cc(/C=C/I)c(NO)nc2=O)O1 |
| InChI | InChI=1S/C15H18IN3O7/c1-8(20)24-7-11-5-12(25-9(2)21)14(26-11)19-6-10(3-4-16)13(18-23)17-15(19)22/h3-4,6,11-12,14,23H,5,7H2,1-2H3,(H,17,18,22)/b4-3+/t11-,12+,14+/m0/s1 |
| InChIKey | XGPKBXRWAMFPKO-UBNAVKRYSA-N |
| XLogP | 1.23 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|