C15H19N3O7 — CID 87408818
[(2S,4R,5R)-4-acetyloxy-5-[5-ethenyl-4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 87408818) has the molecular formula C15H19N3O7 and a molecular weight of 353.33 g/mol. Its IUPAC name is [(2S,4R,5R)-4-acetyloxy-5-[5-ethenyl-4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,4R,5R)-4-acetyloxy-5-[5-ethenyl-4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87408818 |
| Molecular Formula | C15H19N3O7 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [(2S,4R,5R)-4-acetyloxy-5-[5-ethenyl-4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | C=Cc1cn([C@@H]2O[C@H](COC(C)=O)C[C@H]2OC(C)=O)c(=O)nc1NO |
| InChI | InChI=1S/C15H19N3O7/c1-4-10-6-18(15(21)16-13(10)17-22)14-12(24-9(3)20)5-11(25-14)7-23-8(2)19/h4,6,11-12,14,22H,1,5,7H2,2-3H3,(H,16,17,21)/t11-,12+,14+/m0/s1 |
| InChIKey | IBDPXALBZFCETA-OUCADQQQSA-N |
| XLogP | 0.47 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|