C15H16N2O6 — CID 57300257
[(2S,5S)-5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl cyclopropanecarboxylate (PubChem CID 57300257) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is [(2S,5S)-5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl cyclopropanecarboxylate.
| Compound Name | [(2S,5S)-5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 57300257 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [(2S,5S)-5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl cyclopropanecarboxylate |
| SMILES | C#Cc1cn([C@@H]2CC(O)[C@H](COC(=O)C3CC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H16N2O6/c1-2-8-6-17(15(21)16-13(8)19)12-5-10(18)11(23-12)7-22-14(20)9-3-4-9/h1,6,9-12,18H,3-5,7H2,(H,16,19,21)/t10?,11-,12-/m0/s1 |
| InChIKey | BQPXGATZSZFUCH-RAMGSTBQSA-N |
| XLogP | -0.88 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|