C14H17N2O5P3 — CID 59267109
1-[(2R,4R,5R)-5-[bis(phosphanyl)phosphanyloxymethyl]-4-hydroxyoxolan-2-yl]-5-penta-1,4-diynylpyrimidine-2,4-dione (PubChem CID 59267109) has the molecular formula C14H17N2O5P3 and a molecular weight of 386.22 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-[bis(phosphanyl)phosphanyloxymethyl]-4-hydroxyoxolan-2-yl]-5-penta-1,4-diynylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-5-[bis(phosphanyl)phosphanyloxymethyl]-4-hydroxyoxolan-2-yl]-5-penta-1,4-diynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59267109 |
| Molecular Formula | C14H17N2O5P3 |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1-[(2R,4R,5R)-5-[bis(phosphanyl)phosphanyloxymethyl]-4-hydroxyoxolan-2-yl]-5-penta-1,4-diynylpyrimidine-2,4-dione |
| SMILES | C#CCC#Cc1cn([C@H]2C[C@@H](O)[C@@H](COP(P)P)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H17N2O5P3/c1-2-3-4-5-9-7-16(14(19)15-13(9)18)12-6-10(17)11(21-12)8-20-24(22)23/h1,7,10-12,17H,3,6,8,22-23H2,(H,15,18,19)/t10-,11-,12-/m1/s1 |
| InChIKey | PPXSMCNETZYANM-IJLUTSLNSA-N |
| XLogP | 0.55 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|