C11H10F2N2O4 — CID 121487067
1-[(2R,3S,4R,5R)-3,4-difluoro-5-(hydroxymethyl)oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione (PubChem CID 121487067) has the molecular formula C11H10F2N2O4 and a molecular weight of 272.21 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-3,4-difluoro-5-(hydroxymethyl)oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-3,4-difluoro-5-(hydroxymethyl)oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121487067 |
| Molecular Formula | C11H10F2N2O4 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3,4-difluoro-5-(hydroxymethyl)oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione |
| SMILES | C#Cc1cn([C@@H]2O[C@H](CO)[C@@H](F)[C@H]2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H10F2N2O4/c1-2-5-3-15(11(18)14-9(5)17)10-8(13)7(12)6(4-16)19-10/h1,3,6-8,10,16H,4H2,(H,14,17,18)/t6-,7-,8-,10-/m1/s1 |
| InChIKey | GUKHZTWLNSMKNB-FDDDBJFASA-N |
| XLogP | -0.92 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|