C15H26N3O14P3 — CID 121487736
[[(2S,4R,5R)-5-[5-[(E)-6-aminohex-1-enyl]-2,4-dioxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 121487736) has the molecular formula C15H26N3O14P3 and a molecular weight of 565.30 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-[5-[(E)-6-aminohex-1-enyl]-2,4-dioxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4R,5R)-5-[5-[(E)-6-aminohex-1-enyl]-2,4-dioxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 121487736 |
| Molecular Formula | C15H26N3O14P3 |
| Molecular Weight | 565.30 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | [[(2S,4R,5R)-5-[5-[(E)-6-aminohex-1-enyl]-2,4-dioxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCCCC/C=C/c1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H26N3O14P3/c16-6-4-2-1-3-5-10-8-18(15(21)17-13(10)20)14-12(19)7-11(30-14)9-29-34(25,26)32-35(27,28)31-33(22,23)24/h3,5,8,11-12,14,19H,1-2,4,6-7,9,16H2,(H,25,26)(H,27,28)(H,17,20,21)(H2,22,23,24)/b5-3+/t11-,12+,14+/m0/s1 |
| InChIKey | LTXSCWRMRRQYGA-KWZMRPMHSA-N |
| XLogP | -0.33 |
| TPSA | 270.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|