C17H29N4O13P3 — CID 54016443
[[(2S,4R,5R)-5-[4-amino-5-(8-aminooct-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 54016443) has the molecular formula C17H29N4O13P3 and a molecular weight of 590.36 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-[4-amino-5-(8-aminooct-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4R,5R)-5-[4-amino-5-(8-aminooct-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 54016443 |
| Molecular Formula | C17H29N4O13P3 |
| Molecular Weight | 590.36 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | [[(2S,4R,5R)-5-[4-amino-5-(8-aminooct-1-ynyl)-2-oxopyrimidin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCCCCCCC#Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C17H29N4O13P3/c18-8-6-4-2-1-3-5-7-12-10-21(17(23)20-15(12)19)16-14(22)9-13(32-16)11-31-36(27,28)34-37(29,30)33-35(24,25)26/h10,13-14,16,22H,1-4,6,8-9,11,18H2,(H,27,28)(H,29,30)(H2,19,20,23)(H2,24,25,26)/t13-,14+,16+/m0/s1 |
| InChIKey | KVYMCDYHHVQKPQ-SQWLQELKSA-N |
| XLogP | 0.08 |
| TPSA | 276.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|