C11H14B2N2O7P+ — CID 153342045
CID 153342045 (PubChem CID 153342045) has the molecular formula C11H14B2N2O7P+ and a molecular weight of 338.84 g/mol.
| Compound Name | CID 153342045 |
|---|---|
| PubChem CID | 153342045 |
| Molecular Formula | C11H14B2N2O7P+ |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | — |
| SMILES | [B]CO[P+](O)(O)O.[B][C@@H]1CCC(n2cc(C#C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H9BN2O3.CH5BO4P/c1-2-6-5-13(10(15)12-9(6)14)8-4-3-7(11)16-8;2-1-6-7(3,4)5/h1,5,7-8H,3-4H2,(H,12,14,15);3-5H,1H2/q;+1/t7-,8?;/m0./s1 |
| InChIKey | RUTHCUMQLLSJTC-JPPWUZRISA-N |
| XLogP | -1.89 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|