C10H10N2O3S — CID 153342171
5-ethynyl-1-[(5S)-5-hydroxyoxolan-2-yl]-4-sulfanylidenepyrimidin-2-one (PubChem CID 153342171) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 5-ethynyl-1-[(5S)-5-hydroxyoxolan-2-yl]-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 5-ethynyl-1-[(5S)-5-hydroxyoxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 153342171 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 5-ethynyl-1-[(5S)-5-hydroxyoxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| SMILES | C#Cc1cn(C2CC[C@@H](O)O2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C10H10N2O3S/c1-2-6-5-12(10(14)11-9(6)16)7-3-4-8(13)15-7/h1,5,7-8,13H,3-4H2,(H,11,14,16)/t7?,8-/m0/s1 |
| InChIKey | KSQYPPQIBAFVJA-MQWKRIRWSA-N |
| XLogP | 0.51 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|