C9H12BFN2O4S — CID 171528701
CID 171528701 (PubChem CID 171528701) has the molecular formula C9H12BFN2O4S and a molecular weight of 274.08 g/mol.
| Compound Name | CID 171528701 |
|---|---|
| PubChem CID | 171528701 |
| Molecular Formula | C9H12BFN2O4S |
| Molecular Weight | 274.08 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(=S)n(C2CC[C@@H](O)O2)cc1F.[B]CO |
| InChI | InChI=1S/C8H9FN2O3S.CH3BO/c9-4-3-11(8(15)10-7(4)13)5-1-2-6(12)14-5;2-1-3/h3,5-6,12H,1-2H2,(H,10,13,15);3H,1H2/t5?,6-;/m0./s1 |
| InChIKey | KJFFZSBZDVZNGI-PQAGPIFVSA-N |
| XLogP | -0.22 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.08 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|