C10H13B2FN2O5S — CID 166116491
CID 166116491 (PubChem CID 166116491) has the molecular formula C10H13B2FN2O5S and a molecular weight of 313.91 g/mol.
| Compound Name | CID 166116491 |
|---|---|
| PubChem CID | 166116491 |
| Molecular Formula | C10H13B2FN2O5S |
| Molecular Weight | 313.91 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | — |
| SMILES | [B]C1OC(n2cc(F)c(=O)[nH]c2=S)C(C)(O)C1O.[B]CO |
| InChI | InChI=1S/C9H10BFN2O4S.CH3BO/c1-9(16)4(14)5(10)17-7(9)13-2-3(11)6(15)12-8(13)18;2-1-3/h2,4-5,7,14,16H,1H3,(H,12,15,18);3H,1H2 |
| InChIKey | ASQAVPOXRSRONX-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.91 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|