C11H10F2N2O4S — CID 122449969
1-[(2R,4S,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2-sulfanylidenepyrimidin-4-one (PubChem CID 122449969) has the molecular formula C11H10F2N2O4S and a molecular weight of 304.27 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,4S,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 122449969 |
| Molecular Formula | C11H10F2N2O4S |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 1-[(2R,4S,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2-sulfanylidenepyrimidin-4-one |
| SMILES | C#CC1(F)[C@@H](O)[C@@H](CO)O[C@H]1n1cc(F)c(=O)[nH]c1=S |
| InChI | InChI=1S/C11H10F2N2O4S/c1-2-11(13)7(17)6(4-16)19-9(11)15-3-5(12)8(18)14-10(15)20/h1,3,6-7,9,16-17H,4H2,(H,14,18,20)/t6-,7+,9-,11?/m1/s1 |
| InChIKey | SFTUFHIABZQHTP-XNODMDPTSA-N |
| XLogP | -0.36 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|