C11H12N2O4S2 — CID 122453709
1-[(2R,3R,5R)-3-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dithione (PubChem CID 122453709) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-3-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dithione.
| Compound Name | 1-[(2R,3R,5R)-3-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dithione |
|---|---|
| PubChem CID | 122453709 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 1-[(2R,3R,5R)-3-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dithione |
| SMILES | C#C[C@@]1(O)C(O)[C@@H](CO)O[C@H]1n1ccc(=S)[nH]c1=S |
| InChI | InChI=1S/C11H12N2O4S2/c1-2-11(16)8(15)6(5-14)17-9(11)13-4-3-7(18)12-10(13)19/h1,3-4,6,8-9,14-16H,5H2,(H,12,18,19)/t6-,8?,9-,11-/m1/s1 |
| InChIKey | CUYGZNZDKQRRAV-PAGVCZNRSA-N |
| XLogP | -0.11 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|