C14H14N2O4 — CID 91000208
(3R,4R,5R)-2-(benzimidazol-1-yl)-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 91000208) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is (3R,4R,5R)-2-(benzimidazol-1-yl)-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4R,5R)-2-(benzimidazol-1-yl)-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91000208 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (3R,4R,5R)-2-(benzimidazol-1-yl)-3-ethynyl-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#C[C@]1(O)C(n2cnc3ccccc32)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C14H14N2O4/c1-2-14(19)12(18)11(7-17)20-13(14)16-8-15-9-5-3-4-6-10(9)16/h1,3-6,8,11-13,17-19H,7H2/t11-,12-,13?,14-/m1/s1 |
| InChIKey | ZCMBMLCSAKROFU-MVWAYNQESA-N |
| XLogP | -0.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|