C13H15N5O4S — CID 148727205
2-amino-9-[(2R,5S)-3-ethynyl-3-hydroxy-4,5-bis(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione (PubChem CID 148727205) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2-amino-9-[(2R,5S)-3-ethynyl-3-hydroxy-4,5-bis(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione.
| Compound Name | 2-amino-9-[(2R,5S)-3-ethynyl-3-hydroxy-4,5-bis(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione |
|---|---|
| PubChem CID | 148727205 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-amino-9-[(2R,5S)-3-ethynyl-3-hydroxy-4,5-bis(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione |
| SMILES | C#CC1(O)C(CO)[C@@H](CO)O[C@H]1n1cnc2c(=S)nc(N)[nH]c21 |
| InChI | InChI=1S/C13H15N5O4S/c1-2-13(21)6(3-19)7(4-20)22-11(13)18-5-15-8-9(18)16-12(14)17-10(8)23/h1,5-7,11,19-21H,3-4H2,(H3,14,16,17,23)/t6?,7-,11-,13?/m1/s1 |
| InChIKey | OAFWRSHGXMXHCM-YEBZRGLYSA-N |
| XLogP | -1.07 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|