C10H13N5O2S — CID 59859733
2-amino-9-[(2R,4R,5R)-4-hydroxy-5-methyloxolan-2-yl]-3H-purine-6-thione (PubChem CID 59859733) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-methyloxolan-2-yl]-3H-purine-6-thione.
| Compound Name | 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-methyloxolan-2-yl]-3H-purine-6-thione |
|---|---|
| PubChem CID | 59859733 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-amino-9-[(2R,4R,5R)-4-hydroxy-5-methyloxolan-2-yl]-3H-purine-6-thione |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(=S)nc(N)[nH]c32)C[C@H]1O |
| InChI | InChI=1S/C10H13N5O2S/c1-4-5(16)2-6(17-4)15-3-12-7-8(15)13-10(11)14-9(7)18/h3-6,16H,2H2,1H3,(H3,11,13,14,18)/t4-,5-,6-/m1/s1 |
| InChIKey | VTZBYCZKJKILRP-HSUXUTPPSA-N |
| XLogP | 0.74 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|