C11H17N5O5S — CID 5380964
2-amino-9-(3,4,5-trihydroxyoxan-2-yl)-3H-purine-6-thione;methanol (PubChem CID 5380964) has the molecular formula C11H17N5O5S and a molecular weight of 331.35 g/mol. Its IUPAC name is 2-amino-9-(3,4,5-trihydroxyoxan-2-yl)-3H-purine-6-thione;methanol.
| Compound Name | 2-amino-9-(3,4,5-trihydroxyoxan-2-yl)-3H-purine-6-thione;methanol |
|---|---|
| PubChem CID | 5380964 |
| Molecular Formula | C11H17N5O5S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-amino-9-(3,4,5-trihydroxyoxan-2-yl)-3H-purine-6-thione;methanol |
| SMILES | CO.Nc1nc(=S)c2ncn(C3OCC(O)C(O)C3O)c2[nH]1 |
| InChI | InChI=1S/C10H13N5O4S.CH4O/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(16)1-19-9;1-2/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,20);2H,1H3 |
| InChIKey | JSKMXWUWMSSFRT-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|