C10H13N5O8P2S+2 — CID 57370387
[(2R,3S,4R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium (PubChem CID 57370387) has the molecular formula C10H13N5O8P2S+2 and a molecular weight of 425.26 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 57370387 |
| Molecular Formula | C10H13N5O8P2S+2 |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
| SMILES | Nc1nc(=S)c2ncn([C@@H]3O[C@H](CO[P+](=O)O[P+](=O)O)[C@@H](O)[C@H]3O)c2[nH]1 |
| InChI | InChI=1S/C10H11N5O8P2S/c11-10-13-7-4(8(26)14-10)12-2-15(7)9-6(17)5(16)3(22-9)1-21-25(20)23-24(18)19/h2-3,5-6,9,16-17H,1H2,(H2-2,11,13,14,18,19,26)/p+2/t3-,5-,6-,9-/m1/s1 |
| InChIKey | YAZXUKPAVAWWHK-UUOKFMHZSA-P |
| XLogP | 0.03 |
| TPSA | 195.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|