C15H23N5O13P2+2 — CID 57348609
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;(3R,4R)-1,3,4,5-tetrahydroxypentan-2-one (PubChem CID 57348609) has the molecular formula C15H23N5O13P2+2 and a molecular weight of 543.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;(3R,4R)-1,3,4,5-tetrahydroxypentan-2-one.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;(3R,4R)-1,3,4,5-tetrahydroxypentan-2-one |
|---|---|
| PubChem CID | 57348609 |
| Molecular Formula | C15H23N5O13P2+2 |
| Molecular Weight | 543.32 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;(3R,4R)-1,3,4,5-tetrahydroxypentan-2-one |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO[P+](=O)O[P+](=O)O)[C@@H](O)[C@H]1O.O=C(CO)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H12N5O8P2.C5H10O5/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-25(20)23-24(18)19;6-1-3(8)5(10)4(9)2-7/h2-4,6-7,10,16-17H,1H2,(H2-,11,12,13,18,19);3,5-8,10H,1-2H2/q+1;/p+1/t4-,6-,7-,10-;3-,5-/m11/s1 |
| InChIKey | BSYLVEPJHVBTRT-DBBUWLKYSA-O |
| XLogP | -3.37 |
| TPSA | 290.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.32 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|