C15H21N5O8 — CID 54366873
(3R,4R,5R)-1-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-3,4,5,6-tetrahydroxyhexan-2-one (PubChem CID 54366873) has the molecular formula C15H21N5O8 and a molecular weight of 399.36 g/mol. Its IUPAC name is (3R,4R,5R)-1-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-3,4,5,6-tetrahydroxyhexan-2-one.
| Compound Name | (3R,4R,5R)-1-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-3,4,5,6-tetrahydroxyhexan-2-one |
|---|---|
| PubChem CID | 54366873 |
| Molecular Formula | C15H21N5O8 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (3R,4R,5R)-1-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-3,4,5,6-tetrahydroxyhexan-2-one |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CC(=O)[C@H](O)[C@H](O)[C@H](O)CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21N5O8/c16-13-8-14(18-3-17-13)20(4-19-8)15-12(27)11(26)7(28-15)1-5(22)9(24)10(25)6(23)2-21/h3-4,6-7,9-12,15,21,23-27H,1-2H2,(H2,16,17,18)/t6-,7-,9+,10-,11-,12-,15-/m1/s1 |
| InChIKey | UQKJFGGFFVOFHM-KJRMRNPKSA-N |
| XLogP | -3.94 |
| TPSA | 217.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |