C10H11N5O3S — CID 98518118
2-amino-9-[(1R,2S,4S,5S)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3H-purine-6-thione (PubChem CID 98518118) has the molecular formula C10H11N5O3S and a molecular weight of 281.30 g/mol. Its IUPAC name is 2-amino-9-[(1R,2S,4S,5S)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3H-purine-6-thione.
| Compound Name | 2-amino-9-[(1R,2S,4S,5S)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3H-purine-6-thione |
|---|---|
| PubChem CID | 98518118 |
| Molecular Formula | C10H11N5O3S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-amino-9-[(1R,2S,4S,5S)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3H-purine-6-thione |
| SMILES | Nc1nc(=S)c2ncn([C@H]3O[C@@H](CO)[C@@H]4O[C@H]43)c2[nH]1 |
| InChI | InChI=1S/C10H11N5O3S/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6-5(18-6)3(1-16)17-9/h2-3,5-6,9,16H,1H2,(H3,11,13,14,19)/t3-,5-,6+,9-/m0/s1 |
| InChIKey | SOQNQZCJPOKGEP-HJGQOHIQSA-N |
| XLogP | -0.27 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|